| Molecule Type | nucleic acid |
| Residue Name (RNME) | _I1F |
| Formula | C10H12N5O13P3 |
| IUPAC InChI Key | CRGDGGQCXKQNDY-KQYNXXCUSA-N |
| IUPAC InChI | InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1,11H2,(H,21,22)(H,23,24)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| IUPAC Name | |
| Common Name | |
| Canonical SMILES (Daylight) | O[C@@H]1[C@@H](CO[P@@](=[O-])(O[P@@](=[O-])(O[P@](=O)(O)[O-])O)O)O[C@H]([C@@H]1O)N1C=[N]=C2C1=[N]=[CH]=[N]=C2N |
| Number of atoms | 43 |
| Net Charge | -4 |
| Forcefield | multiple |
| Molecule ID | 51 |
| PDB hetId | ATP |
| Visibility | Public |
| Molecule Tags |
Generating ...
Generating ...
Generating ...
Click table to toggle details.
| Processing Stage | Template | Semi-Empirical QM (QM0) | DFT QM (QM1) | DFT Hessian QM (QM2) | |
|---|---|---|---|---|---|
| Calculation | None | Energy Minization | Energy Minization | Hessian | |
| Level of Theory | None | Semi-Empirical / SCF | DFT (B3LYP/6-31G*) | DFT (B3LYP/6-31G*) | |
| Default Size Limit (Atoms) | 1000 | 500 | 50 | 40 | |
| Content of MD Topology | |||||
| Charges Derived From | None | MOPAC | Merz-Singh-Kollman | Merz-Singh-Kollman | |
| Geometry | User Provided | Optimized | Optimized | Optimized | |
| Non-Bonded Interactions | Bonds | Rule Based: Parameters are asigned from existing parameters with a set of rules based on atom types and geometry. | Hessian Based: Force constant are calculated from the QM potential. New parameters are created when no suitable parameters exists. | ||
| Angles | |||||
| Dihedrals | |||||
| Current Processing State | Completed |
| Total Processing Time | 0:00:01 (hh:mm:ss) |
Compare All Topologies (7)RMSD Matrix (7)
| Molid | Formula | Iupac | Atoms | Charge | Curation | Details | Δ Qm Optimized Energy (kJ.mol-1) | Compare |
|---|---|---|---|---|---|---|---|---|
| 20684 | C10H12N5O13P3 | - | 43 | -4 | ATB | -15.323 | Compare with | |
| 9104 | C10H12N5O13P3 | - | 43 | -4 | ATB | 7.000 | Compare with | |
| 253674 | C10H12N5O13P3 | - | 43 | -4 | ATB | 15.674 | Compare with | |
| 20683 | C10H12N5O13P3 | - | 43 | -4 | ATB | 12.225 | Compare with | |
| 20713 | C10H12N5O13P3 | - | 43 | -4 | ATB | 1.250 | Compare with | |
| 17641 | C10H12N5O13P3 | - | 43 | -4 | ATB | 11.505 | Compare with |
| Molid | Formula | Iupac | Atoms | Charge | Curation | Details |
|---|---|---|---|---|---|---|
| 325575 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 17641 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 26831 | C10H13N5O13P3 | [(2R,3S,4R,5R)-5-(6- ... | 44 | -3 | ATB | |
| 36159 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 35629 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 253548 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 342560 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 20684 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 103002 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 305798 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 9104 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 24624 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 20683 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 26844 | C10H13N5O13P3 | [(2R,3S,4R,5R)-5-(6- ... | 44 | -3 | ATB | |
| 36179 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 20713 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 35819 | C10H16N5O13P3 | - | 47 | 0 | ATB | |
| 253674 | C10H12N5O13P3 | - | 43 | -4 | ATB | |
| 32227 | C10H16N5O13P3 | - | 47 | 0 | Error | Error |
| 246246 | C10H12N5O13P3 | - | 43 | -4 | Error | Error |
| 302772 | C10H10N5O13P3 | - | 41 | -4 | Error | Error |
| 29013 | C10H12N5O13P3 | - | 43 | -4 | Error | Error |
| 36067 | C10H16N5O13P3 | - | 47 | 0 | Processing | Error |
| 271918 | C10H13N5O13P3 | [(2R,3S,4R,5R)-5-(6- ... | 44 | -3 | Error | Error |
| 34311 | C10H12N5O13P3 | - | 43 | -4 | Error | Error |
| 248881 | C10H12N5O13P3 | [(2R,3S,4R,5R)-5-(6- ... | 43 | -3 | Error | Error |
| 340235 | C10H10N5O13P3 | - | 41 | 0 | Error | Error |
| 304818 | C10H12N5O13P3 | [(2R,3S,4R,5R)-5-(6- ... | 43 | -3 | Error | Error |
Access to this feature is currently restricted
The maximum QM level is computed using the ATB Pipeline atom limits but can be manually increased on a case by case basis.
Access to this feature is currently restricted